C19H18N6OS — CID 143487458
N'-[4-(dimethylamino)-2-formylthieno[2,3-b]pyridin-3-yl]-N-(2-methyl-3H-benzimidazol-5-yl)methanimidamide (PubChem CID 143487458) has the molecular formula C19H18N6OS and a molecular weight of 378.46 g/mol. Its IUPAC name is N'-[4-(dimethylamino)-2-formylthieno[2,3-b]pyridin-3-yl]-N-(2-methyl-3H-benzimidazol-5-yl)methanimidamide.
| Compound Name | N'-[4-(dimethylamino)-2-formylthieno[2,3-b]pyridin-3-yl]-N-(2-methyl-3H-benzimidazol-5-yl)methanimidamide |
|---|---|
| PubChem CID | 143487458 |
| Molecular Formula | C19H18N6OS |
| Molecular Weight | 378.46 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | N'-[4-(dimethylamino)-2-formylthieno[2,3-b]pyridin-3-yl]-N-(2-methyl-3H-benzimidazol-5-yl)methanimidamide |
| SMILES | Cc1nc2ccc(N/C=N/c3c(C=O)sc4nccc(N(C)C)c34)cc2[nH]1 |
| InChI | InChI=1S/C19H18N6OS/c1-11-23-13-5-4-12(8-14(13)24-11)21-10-22-18-16(9-26)27-19-17(18)15(25(2)3)6-7-20-19/h4-10H,1-3H3,(H,21,22)(H,23,24) |
| InChIKey | WMHLAHZFVASBJH-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.46 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|