C15H13N5O — CID 693866
2-methyl-N-(pyridin-2-ylmethylideneamino)-3H-benzimidazole-5-carboxamide (PubChem CID 693866) has the molecular formula C15H13N5O and a molecular weight of 279.30 g/mol. Its IUPAC name is 2-methyl-N-(pyridin-2-ylmethylideneamino)-3H-benzimidazole-5-carboxamide.
| Compound Name | 2-methyl-N-(pyridin-2-ylmethylideneamino)-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 693866 |
| Molecular Formula | C15H13N5O |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | 2-methyl-N-(pyridin-2-ylmethylideneamino)-3H-benzimidazole-5-carboxamide |
| SMILES | Cc1nc2ccc(C(=O)NN=Cc3ccccn3)cc2[nH]1 |
| InChI | InChI=1S/C15H13N5O/c1-10-18-13-6-5-11(8-14(13)19-10)15(21)20-17-9-12-4-2-3-7-16-12/h2-9H,1H3,(H,18,19)(H,20,21) |
| InChIKey | CHXHRZYGQAAUPH-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|