C15H13BrCl2O2 — CID 63427922
1-(3-bromo-5-chloro-2-methoxyphenyl)-2-(2-chlorophenyl)ethanol (PubChem CID 63427922) has the molecular formula C15H13BrCl2O2 and a molecular weight of 376.08 g/mol. Its IUPAC name is 1-(3-bromo-5-chloro-2-methoxyphenyl)-2-(2-chlorophenyl)ethanol.
| Compound Name | 1-(3-bromo-5-chloro-2-methoxyphenyl)-2-(2-chlorophenyl)ethanol |
|---|---|
| PubChem CID | 63427922 |
| Molecular Formula | C15H13BrCl2O2 |
| Molecular Weight | 376.08 g/mol |
| Exact Mass | 373.95 |
| IUPAC Name | 1-(3-bromo-5-chloro-2-methoxyphenyl)-2-(2-chlorophenyl)ethanol |
| SMILES | COc1c(Br)cc(Cl)cc1C(O)Cc1ccccc1Cl |
| InChI | InChI=1S/C15H13BrCl2O2/c1-20-15-11(7-10(17)8-12(15)16)14(19)6-9-4-2-3-5-13(9)18/h2-5,7-8,14,19H,6H2,1H3 |
| InChIKey | UTIOFOYOAONXHG-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.08 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |