About 2,2-dichloro-N'-dianilinophosphinothioyl-N-phenylpropanimidamide
2,2-dichloro-N'-dianilinophosphinothioyl-N-phenylpropanimidamide (PubChem CID 6342895) has the molecular formula C21H21Cl2N4PS
and a molecular weight of 463.37 g/mol. Its IUPAC name is 2,2-dichloro-N'-dianilinophosphinothioyl-N-phenylpropanimidamide.
Molecular Properties
| Compound Name | 2,2-dichloro-N'-dianilinophosphinothioyl-N-phenylpropanimidamide |
| PubChem CID | 6342895 |
| Molecular Formula | C21H21Cl2N4PS |
| Molecular Weight | 463.37 g/mol |
| Exact Mass | 462.06 |
| IUPAC Name | 2,2-dichloro-N'-dianilinophosphinothioyl-N-phenylpropanimidamide |
| SMILES | CC(Cl)(Cl)/C(=N\P(=S)(Nc1ccccc1)Nc1ccccc1)Nc1ccccc1 |
| InChI | InChI=1S/C21H21Cl2N4PS/c1-21(22,23)20(24-17-11-5-2-6-12-17)27-28(29,25-18-13-7-3-8-14-18)26-19-15-9-4-10-16-19/h2-16H,1H3,(H3,24,25,26,27,29) |
| InChIKey | AJRLMJIDHHCQRY-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 48.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 463.37 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dichloro-N'-dianilinophosphinothioyl-N-phenylpropanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dichloro-N'-dianilinophosphinothioyl-N-phenylpropanimidamide?
The IUPAC name of 2,2-dichloro-N'-dianilinophosphinothioyl-N-phenylpropanimidamide (CID 6342895) is 2,2-dichloro-N'-dianilinophosphinothioyl-N-phenylpropanimidamide.
What is the SMILES notation for 2,2-dichloro-N'-dianilinophosphinothioyl-N-phenylpropanimidamide?
The canonical SMILES for 2,2-dichloro-N'-dianilinophosphinothioyl-N-phenylpropanimidamide is CC(Cl)(Cl)/C(=N\P(=S)(Nc1ccccc1)Nc1ccccc1)Nc1ccccc1.
What is the InChIKey of 2,2-dichloro-N'-dianilinophosphinothioyl-N-phenylpropanimidamide?
The InChIKey is AJRLMJIDHHCQRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21Cl2N4PS/c1-21(22,23)20(24-17-11-5-2-6-12-17)27-28(29,25-18-13-7-3-8-14-18)26-19-15-9-4-10-16-19/h2-16H,1H3,(H3,24,25,26,27,29).
What are the key properties of 2,2-dichloro-N'-dianilinophosphinothioyl-N-phenylpropanimidamide?
2,2-dichloro-N'-dianilinophosphinothioyl-N-phenylpropanimidamide has a molecular weight of 463.37 g/mol, XLogP of 7.14, 7 rotatable bonds, 3 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dichloro-N'-dianilinophosphinothioyl-N-phenylpropanimidamide is sourced from PubChem (CID 6342895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).