C19H23ClO — CID 63429785
2-[chloro-[4-(2-methoxyethyl)phenyl]methyl]-1,3,5-trimethylbenzene (PubChem CID 63429785) has the molecular formula C19H23ClO and a molecular weight of 302.85 g/mol. Its IUPAC name is 2-[chloro-[4-(2-methoxyethyl)phenyl]methyl]-1,3,5-trimethylbenzene.
| Compound Name | 2-[chloro-[4-(2-methoxyethyl)phenyl]methyl]-1,3,5-trimethylbenzene |
|---|---|
| PubChem CID | 63429785 |
| Molecular Formula | C19H23ClO |
| Molecular Weight | 302.85 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 2-[chloro-[4-(2-methoxyethyl)phenyl]methyl]-1,3,5-trimethylbenzene |
| SMILES | COCCc1ccc(C(Cl)c2c(C)cc(C)cc2C)cc1 |
| InChI | InChI=1S/C19H23ClO/c1-13-11-14(2)18(15(3)12-13)19(20)17-7-5-16(6-8-17)9-10-21-4/h5-8,11-12,19H,9-10H2,1-4H3 |
| InChIKey | WMMHPNRFBWQMFF-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.85 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|