C17H17BrCl2O — CID 63431203
1-bromo-5-chloro-3-[1-chloro-2-(3,4-dimethylphenyl)ethyl]-2-methoxybenzene (PubChem CID 63431203) has the molecular formula C17H17BrCl2O and a molecular weight of 388.13 g/mol. Its IUPAC name is 1-bromo-5-chloro-3-[1-chloro-2-(3,4-dimethylphenyl)ethyl]-2-methoxybenzene.
| Compound Name | 1-bromo-5-chloro-3-[1-chloro-2-(3,4-dimethylphenyl)ethyl]-2-methoxybenzene |
|---|---|
| PubChem CID | 63431203 |
| Molecular Formula | C17H17BrCl2O |
| Molecular Weight | 388.13 g/mol |
| Exact Mass | 385.98 |
| IUPAC Name | 1-bromo-5-chloro-3-[1-chloro-2-(3,4-dimethylphenyl)ethyl]-2-methoxybenzene |
| SMILES | COc1c(Br)cc(Cl)cc1C(Cl)Cc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C17H17BrCl2O/c1-10-4-5-12(6-11(10)2)7-16(20)14-8-13(19)9-15(18)17(14)21-3/h4-6,8-9,16H,7H2,1-3H3 |
| InChIKey | JAJHUFVYWIBPSI-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.13 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|