C14H10Cl2F2O — CID 63434674
2-chloro-1-[chloro-(3,4-difluorophenyl)methyl]-4-methoxybenzene (PubChem CID 63434674) has the molecular formula C14H10Cl2F2O and a molecular weight of 303.14 g/mol. Its IUPAC name is 2-chloro-1-[chloro-(3,4-difluorophenyl)methyl]-4-methoxybenzene.
| Compound Name | 2-chloro-1-[chloro-(3,4-difluorophenyl)methyl]-4-methoxybenzene |
|---|---|
| PubChem CID | 63434674 |
| Molecular Formula | C14H10Cl2F2O |
| Molecular Weight | 303.14 g/mol |
| Exact Mass | 302.01 |
| IUPAC Name | 2-chloro-1-[chloro-(3,4-difluorophenyl)methyl]-4-methoxybenzene |
| SMILES | COc1ccc(C(Cl)c2ccc(F)c(F)c2)c(Cl)c1 |
| InChI | InChI=1S/C14H10Cl2F2O/c1-19-9-3-4-10(11(15)7-9)14(16)8-2-5-12(17)13(18)6-8/h2-7,14H,1H3 |
| InChIKey | KLYBEEFPHDOVJN-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.14 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|