C19H22BrCl — CID 63438087
1-[1-bromo-2-(3-chlorophenyl)ethyl]-2,3,4,5,6-pentamethylbenzene (PubChem CID 63438087) has the molecular formula C19H22BrCl and a molecular weight of 365.74 g/mol. Its IUPAC name is 1-[1-bromo-2-(3-chlorophenyl)ethyl]-2,3,4,5,6-pentamethylbenzene.
| Compound Name | 1-[1-bromo-2-(3-chlorophenyl)ethyl]-2,3,4,5,6-pentamethylbenzene |
|---|---|
| PubChem CID | 63438087 |
| Molecular Formula | C19H22BrCl |
| Molecular Weight | 365.74 g/mol |
| Exact Mass | 364.06 |
| IUPAC Name | 1-[1-bromo-2-(3-chlorophenyl)ethyl]-2,3,4,5,6-pentamethylbenzene |
| SMILES | Cc1c(C)c(C)c(C(Br)Cc2cccc(Cl)c2)c(C)c1C |
| InChI | InChI=1S/C19H22BrCl/c1-11-12(2)14(4)19(15(5)13(11)3)18(20)10-16-7-6-8-17(21)9-16/h6-9,18H,10H2,1-5H3 |
| InChIKey | QFZMKFROBISZBQ-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.74 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|