C14H7BrClF5 — CID 63529741
1-[1-bromo-2-(3-chlorophenyl)ethyl]-2,3,4,5,6-pentafluorobenzene (PubChem CID 63529741) has the molecular formula C14H7BrClF5 and a molecular weight of 385.56 g/mol. Its IUPAC name is 1-[1-bromo-2-(3-chlorophenyl)ethyl]-2,3,4,5,6-pentafluorobenzene.
| Compound Name | 1-[1-bromo-2-(3-chlorophenyl)ethyl]-2,3,4,5,6-pentafluorobenzene |
|---|---|
| PubChem CID | 63529741 |
| Molecular Formula | C14H7BrClF5 |
| Molecular Weight | 385.56 g/mol |
| Exact Mass | 383.93 |
| IUPAC Name | 1-[1-bromo-2-(3-chlorophenyl)ethyl]-2,3,4,5,6-pentafluorobenzene |
| SMILES | Fc1c(F)c(F)c(C(Br)Cc2cccc(Cl)c2)c(F)c1F |
| InChI | InChI=1S/C14H7BrClF5/c15-8(5-6-2-1-3-7(16)4-6)9-10(17)12(19)14(21)13(20)11(9)18/h1-4,8H,5H2 |
| InChIKey | YGLCQOGTDGGXRS-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.56 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|