C15H23BrS — CID 63441929
2-[bromo-(4-butylcyclohexyl)methyl]thiophene (PubChem CID 63441929) has the molecular formula C15H23BrS and a molecular weight of 315.32 g/mol. Its IUPAC name is 2-[bromo-(4-butylcyclohexyl)methyl]thiophene.
| Compound Name | 2-[bromo-(4-butylcyclohexyl)methyl]thiophene |
|---|---|
| PubChem CID | 63441929 |
| Molecular Formula | C15H23BrS |
| Molecular Weight | 315.32 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | 2-[bromo-(4-butylcyclohexyl)methyl]thiophene |
| SMILES | CCCCC1CCC(C(Br)c2cccs2)CC1 |
| InChI | InChI=1S/C15H23BrS/c1-2-3-5-12-7-9-13(10-8-12)15(16)14-6-4-11-17-14/h4,6,11-13,15H,2-3,5,7-10H2,1H3 |
| InChIKey | DMAFVCMXAUNDMG-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.32 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|