C11H7BrCl2S — CID 63442411
2-[bromo-(2,3-dichlorophenyl)methyl]thiophene (PubChem CID 63442411) has the molecular formula C11H7BrCl2S and a molecular weight of 322.05 g/mol. Its IUPAC name is 2-[bromo-(2,3-dichlorophenyl)methyl]thiophene.
| Compound Name | 2-[bromo-(2,3-dichlorophenyl)methyl]thiophene |
|---|---|
| PubChem CID | 63442411 |
| Molecular Formula | C11H7BrCl2S |
| Molecular Weight | 322.05 g/mol |
| Exact Mass | 319.88 |
| IUPAC Name | 2-[bromo-(2,3-dichlorophenyl)methyl]thiophene |
| SMILES | Clc1cccc(C(Br)c2cccs2)c1Cl |
| InChI | InChI=1S/C11H7BrCl2S/c12-10(9-5-2-6-15-9)7-3-1-4-8(13)11(7)14/h1-6,10H |
| InChIKey | XJHRFMTXRPLGHN-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.05 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|