C13H12Br2S — CID 63444428
2-bromo-5-[bromo-(3,5-dimethylphenyl)methyl]thiophene (PubChem CID 63444428) has the molecular formula C13H12Br2S and a molecular weight of 360.11 g/mol. Its IUPAC name is 2-bromo-5-[bromo-(3,5-dimethylphenyl)methyl]thiophene.
| Compound Name | 2-bromo-5-[bromo-(3,5-dimethylphenyl)methyl]thiophene |
|---|---|
| PubChem CID | 63444428 |
| Molecular Formula | C13H12Br2S |
| Molecular Weight | 360.11 g/mol |
| Exact Mass | 357.90 |
| IUPAC Name | 2-bromo-5-[bromo-(3,5-dimethylphenyl)methyl]thiophene |
| SMILES | Cc1cc(C)cc(C(Br)c2ccc(Br)s2)c1 |
| InChI | InChI=1S/C13H12Br2S/c1-8-5-9(2)7-10(6-8)13(15)11-3-4-12(14)16-11/h3-7,13H,1-2H3 |
| InChIKey | UQSFMMHNZVYZSU-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.11 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|