C14H10Br2N2O2S — CID 61095893
7-[bromo-(5-bromothiophen-2-yl)methyl]-1,5-dihydro-1,5-benzodiazepine-2,4-dione (PubChem CID 61095893) has the molecular formula C14H10Br2N2O2S and a molecular weight of 430.12 g/mol. Its IUPAC name is 7-[bromo-(5-bromothiophen-2-yl)methyl]-1,5-dihydro-1,5-benzodiazepine-2,4-dione.
| Compound Name | 7-[bromo-(5-bromothiophen-2-yl)methyl]-1,5-dihydro-1,5-benzodiazepine-2,4-dione |
|---|---|
| PubChem CID | 61095893 |
| Molecular Formula | C14H10Br2N2O2S |
| Molecular Weight | 430.12 g/mol |
| Exact Mass | 427.88 |
| IUPAC Name | 7-[bromo-(5-bromothiophen-2-yl)methyl]-1,5-dihydro-1,5-benzodiazepine-2,4-dione |
| SMILES | O=C1CC(=O)Nc2cc(C(Br)c3ccc(Br)s3)ccc2N1 |
| InChI | InChI=1S/C14H10Br2N2O2S/c15-11-4-3-10(21-11)14(16)7-1-2-8-9(5-7)18-13(20)6-12(19)17-8/h1-5,14H,6H2,(H,17,19)(H,18,20) |
| InChIKey | LMAXLCGJTHDBHM-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.12 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|