C18H23ClN2 — CID 63446295
3-(chloromethyl)-N-methyl-N-(3-methylcyclohexyl)isoquinolin-1-amine (PubChem CID 63446295) has the molecular formula C18H23ClN2 and a molecular weight of 302.85 g/mol. Its IUPAC name is 3-(chloromethyl)-N-methyl-N-(3-methylcyclohexyl)isoquinolin-1-amine.
| Compound Name | 3-(chloromethyl)-N-methyl-N-(3-methylcyclohexyl)isoquinolin-1-amine |
|---|---|
| PubChem CID | 63446295 |
| Molecular Formula | C18H23ClN2 |
| Molecular Weight | 302.85 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 3-(chloromethyl)-N-methyl-N-(3-methylcyclohexyl)isoquinolin-1-amine |
| SMILES | CC1CCCC(N(C)c2nc(CCl)cc3ccccc23)C1 |
| InChI | InChI=1S/C18H23ClN2/c1-13-6-5-8-16(10-13)21(2)18-17-9-4-3-7-14(17)11-15(12-19)20-18/h3-4,7,9,11,13,16H,5-6,8,10,12H2,1-2H3 |
| InChIKey | OTKOJRJXXSEGLW-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.85 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|