C16H19ClFN3 — CID 63446305
4-(chloromethyl)-N-ethyl-N-(2-fluorophenyl)-2-propan-2-ylpyrimidin-5-amine (PubChem CID 63446305) has the molecular formula C16H19ClFN3 and a molecular weight of 307.80 g/mol. Its IUPAC name is 4-(chloromethyl)-N-ethyl-N-(2-fluorophenyl)-2-propan-2-ylpyrimidin-5-amine.
| Compound Name | 4-(chloromethyl)-N-ethyl-N-(2-fluorophenyl)-2-propan-2-ylpyrimidin-5-amine |
|---|---|
| PubChem CID | 63446305 |
| Molecular Formula | C16H19ClFN3 |
| Molecular Weight | 307.80 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | 4-(chloromethyl)-N-ethyl-N-(2-fluorophenyl)-2-propan-2-ylpyrimidin-5-amine |
| SMILES | CCN(c1ccccc1F)c1cnc(C(C)C)nc1CCl |
| InChI | InChI=1S/C16H19ClFN3/c1-4-21(14-8-6-5-7-12(14)18)15-10-19-16(11(2)3)20-13(15)9-17/h5-8,10-11H,4,9H2,1-3H3 |
| InChIKey | LZSAETZLMBEBJY-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.80 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|