C15H19ClN4 — CID 62087271
4-(chloromethyl)-N-methyl-2-propan-2-yl-N-(pyridin-2-ylmethyl)pyrimidin-5-amine (PubChem CID 62087271) has the molecular formula C15H19ClN4 and a molecular weight of 290.80 g/mol. Its IUPAC name is 4-(chloromethyl)-N-methyl-2-propan-2-yl-N-(pyridin-2-ylmethyl)pyrimidin-5-amine.
| Compound Name | 4-(chloromethyl)-N-methyl-2-propan-2-yl-N-(pyridin-2-ylmethyl)pyrimidin-5-amine |
|---|---|
| PubChem CID | 62087271 |
| Molecular Formula | C15H19ClN4 |
| Molecular Weight | 290.80 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 4-(chloromethyl)-N-methyl-2-propan-2-yl-N-(pyridin-2-ylmethyl)pyrimidin-5-amine |
| SMILES | CC(C)c1ncc(N(C)Cc2ccccn2)c(CCl)n1 |
| InChI | InChI=1S/C15H19ClN4/c1-11(2)15-18-9-14(13(8-16)19-15)20(3)10-12-6-4-5-7-17-12/h4-7,9,11H,8,10H2,1-3H3 |
| InChIKey | HVUJOEICPOSYRA-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.80 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|