C16H26ClN3 — CID 63446591
4-(chloromethyl)-N-methyl-N-(2-methylcyclohexyl)-2-propan-2-ylpyrimidin-5-amine (PubChem CID 63446591) has the molecular formula C16H26ClN3 and a molecular weight of 295.86 g/mol. Its IUPAC name is 4-(chloromethyl)-N-methyl-N-(2-methylcyclohexyl)-2-propan-2-ylpyrimidin-5-amine.
| Compound Name | 4-(chloromethyl)-N-methyl-N-(2-methylcyclohexyl)-2-propan-2-ylpyrimidin-5-amine |
|---|---|
| PubChem CID | 63446591 |
| Molecular Formula | C16H26ClN3 |
| Molecular Weight | 295.86 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | 4-(chloromethyl)-N-methyl-N-(2-methylcyclohexyl)-2-propan-2-ylpyrimidin-5-amine |
| SMILES | CC(C)c1ncc(N(C)C2CCCCC2C)c(CCl)n1 |
| InChI | InChI=1S/C16H26ClN3/c1-11(2)16-18-10-15(13(9-17)19-16)20(4)14-8-6-5-7-12(14)3/h10-12,14H,5-9H2,1-4H3 |
| InChIKey | PMMZMQFNUSGXJX-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.86 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|