C18H18BrFO — CID 63447486
5-[1-bromo-2-(3-fluorophenyl)ethyl]-2,2-dimethyl-3H-1-benzofuran (PubChem CID 63447486) has the molecular formula C18H18BrFO and a molecular weight of 349.24 g/mol. Its IUPAC name is 5-[1-bromo-2-(3-fluorophenyl)ethyl]-2,2-dimethyl-3H-1-benzofuran.
| Compound Name | 5-[1-bromo-2-(3-fluorophenyl)ethyl]-2,2-dimethyl-3H-1-benzofuran |
|---|---|
| PubChem CID | 63447486 |
| Molecular Formula | C18H18BrFO |
| Molecular Weight | 349.24 g/mol |
| Exact Mass | 348.05 |
| IUPAC Name | 5-[1-bromo-2-(3-fluorophenyl)ethyl]-2,2-dimethyl-3H-1-benzofuran |
| SMILES | CC1(C)Cc2cc(C(Br)Cc3cccc(F)c3)ccc2O1 |
| InChI | InChI=1S/C18H18BrFO/c1-18(2)11-14-10-13(6-7-17(14)21-18)16(19)9-12-4-3-5-15(20)8-12/h3-8,10,16H,9,11H2,1-2H3 |
| InChIKey | HMTYUYQGPRBZCO-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.24 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|