C17H16ClFO — CID 63447349
5-[chloro-(3-fluorophenyl)methyl]-2,2-dimethyl-3H-1-benzofuran (PubChem CID 63447349) has the molecular formula C17H16ClFO and a molecular weight of 290.77 g/mol. Its IUPAC name is 5-[chloro-(3-fluorophenyl)methyl]-2,2-dimethyl-3H-1-benzofuran.
| Compound Name | 5-[chloro-(3-fluorophenyl)methyl]-2,2-dimethyl-3H-1-benzofuran |
|---|---|
| PubChem CID | 63447349 |
| Molecular Formula | C17H16ClFO |
| Molecular Weight | 290.77 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 5-[chloro-(3-fluorophenyl)methyl]-2,2-dimethyl-3H-1-benzofuran |
| SMILES | CC1(C)Cc2cc(C(Cl)c3cccc(F)c3)ccc2O1 |
| InChI | InChI=1S/C17H16ClFO/c1-17(2)10-13-8-12(6-7-15(13)20-17)16(18)11-4-3-5-14(19)9-11/h3-9,16H,10H2,1-2H3 |
| InChIKey | RAMZNQXTYGHLAH-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.77 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|