C17H15BrF2O — CID 63447758
5-[bromo-(2,4-difluorophenyl)methyl]-2,2-dimethyl-3H-1-benzofuran (PubChem CID 63447758) has the molecular formula C17H15BrF2O and a molecular weight of 353.21 g/mol. Its IUPAC name is 5-[bromo-(2,4-difluorophenyl)methyl]-2,2-dimethyl-3H-1-benzofuran.
| Compound Name | 5-[bromo-(2,4-difluorophenyl)methyl]-2,2-dimethyl-3H-1-benzofuran |
|---|---|
| PubChem CID | 63447758 |
| Molecular Formula | C17H15BrF2O |
| Molecular Weight | 353.21 g/mol |
| Exact Mass | 352.03 |
| IUPAC Name | 5-[bromo-(2,4-difluorophenyl)methyl]-2,2-dimethyl-3H-1-benzofuran |
| SMILES | CC1(C)Cc2cc(C(Br)c3ccc(F)cc3F)ccc2O1 |
| InChI | InChI=1S/C17H15BrF2O/c1-17(2)9-11-7-10(3-6-15(11)21-17)16(18)13-5-4-12(19)8-14(13)20/h3-8,16H,9H2,1-2H3 |
| InChIKey | AXNWHPAXLHVPTD-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.21 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|