C17H13BrOS — CID 63447822
5-[1-benzothiophen-2-yl(bromo)methyl]-1,3-dihydro-2-benzofuran (PubChem CID 63447822) has the molecular formula C17H13BrOS and a molecular weight of 345.26 g/mol. Its IUPAC name is 5-[1-benzothiophen-2-yl(bromo)methyl]-1,3-dihydro-2-benzofuran.
| Compound Name | 5-[1-benzothiophen-2-yl(bromo)methyl]-1,3-dihydro-2-benzofuran |
|---|---|
| PubChem CID | 63447822 |
| Molecular Formula | C17H13BrOS |
| Molecular Weight | 345.26 g/mol |
| Exact Mass | 343.99 |
| IUPAC Name | 5-[1-benzothiophen-2-yl(bromo)methyl]-1,3-dihydro-2-benzofuran |
| SMILES | BrC(c1ccc2c(c1)COC2)c1cc2ccccc2s1 |
| InChI | InChI=1S/C17H13BrOS/c18-17(12-5-6-13-9-19-10-14(13)7-12)16-8-11-3-1-2-4-15(11)20-16/h1-8,17H,9-10H2 |
| InChIKey | TYZJVUPRWZRCHI-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.26 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|