C18H21BrO — CID 63447968
2-[bromo-(3,4-dimethylphenyl)methyl]-1-ethoxy-4-methylbenzene (PubChem CID 63447968) has the molecular formula C18H21BrO and a molecular weight of 333.27 g/mol. Its IUPAC name is 2-[bromo-(3,4-dimethylphenyl)methyl]-1-ethoxy-4-methylbenzene.
| Compound Name | 2-[bromo-(3,4-dimethylphenyl)methyl]-1-ethoxy-4-methylbenzene |
|---|---|
| PubChem CID | 63447968 |
| Molecular Formula | C18H21BrO |
| Molecular Weight | 333.27 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | 2-[bromo-(3,4-dimethylphenyl)methyl]-1-ethoxy-4-methylbenzene |
| SMILES | CCOc1ccc(C)cc1C(Br)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C18H21BrO/c1-5-20-17-9-6-12(2)10-16(17)18(19)15-8-7-13(3)14(4)11-15/h6-11,18H,5H2,1-4H3 |
| InChIKey | CACNEDYELYCQPM-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.27 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|