C16H26FN — CID 63453830
N-(2,6-dimethylheptan-4-yl)-3-fluoro-2-methylaniline (PubChem CID 63453830) has the molecular formula C16H26FN and a molecular weight of 251.39 g/mol. Its IUPAC name is N-(2,6-dimethylheptan-4-yl)-3-fluoro-2-methylaniline.
| Compound Name | N-(2,6-dimethylheptan-4-yl)-3-fluoro-2-methylaniline |
|---|---|
| PubChem CID | 63453830 |
| Molecular Formula | C16H26FN |
| Molecular Weight | 251.39 g/mol |
| Exact Mass | 251.20 |
| IUPAC Name | N-(2,6-dimethylheptan-4-yl)-3-fluoro-2-methylaniline |
| SMILES | Cc1c(F)cccc1NC(CC(C)C)CC(C)C |
| InChI | InChI=1S/C16H26FN/c1-11(2)9-14(10-12(3)4)18-16-8-6-7-15(17)13(16)5/h6-8,11-12,14,18H,9-10H2,1-5H3 |
| InChIKey | CWFZRVICFRINHT-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.39 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |