C13H11BrF3NS — CID 63455421
N-[(5-bromothiophen-2-yl)methyl]-4-methyl-3-(trifluoromethyl)aniline (PubChem CID 63455421) has the molecular formula C13H11BrF3NS and a molecular weight of 350.20 g/mol. Its IUPAC name is N-[(5-bromothiophen-2-yl)methyl]-4-methyl-3-(trifluoromethyl)aniline.
| Compound Name | N-[(5-bromothiophen-2-yl)methyl]-4-methyl-3-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 63455421 |
| Molecular Formula | C13H11BrF3NS |
| Molecular Weight | 350.20 g/mol |
| Exact Mass | 348.97 |
| IUPAC Name | N-[(5-bromothiophen-2-yl)methyl]-4-methyl-3-(trifluoromethyl)aniline |
| SMILES | Cc1ccc(NCc2ccc(Br)s2)cc1C(F)(F)F |
| InChI | InChI=1S/C13H11BrF3NS/c1-8-2-3-9(6-11(8)13(15,16)17)18-7-10-4-5-12(14)19-10/h2-6,18H,7H2,1H3 |
| InChIKey | IICWXDDYNALIJR-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.20 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |