C15H27NS — CID 63456390
5-methyl-N-(1-thiophen-2-ylbutyl)hexan-2-amine (PubChem CID 63456390) has the molecular formula C15H27NS and a molecular weight of 253.45 g/mol. Its IUPAC name is 5-methyl-N-(1-thiophen-2-ylbutyl)hexan-2-amine.
| Compound Name | 5-methyl-N-(1-thiophen-2-ylbutyl)hexan-2-amine |
|---|---|
| PubChem CID | 63456390 |
| Molecular Formula | C15H27NS |
| Molecular Weight | 253.45 g/mol |
| Exact Mass | 253.19 |
| IUPAC Name | 5-methyl-N-(1-thiophen-2-ylbutyl)hexan-2-amine |
| SMILES | CCCC(NC(C)CCC(C)C)c1cccs1 |
| InChI | InChI=1S/C15H27NS/c1-5-7-14(15-8-6-11-17-15)16-13(4)10-9-12(2)3/h6,8,11-14,16H,5,7,9-10H2,1-4H3 |
| InChIKey | UXWCZGGEJKHCRY-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.45 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |