C11H14BN3O2S — CID 63456783
[4-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanylmethyl]phenyl]boronic acid (PubChem CID 63456783) has the molecular formula C11H14BN3O2S and a molecular weight of 263.13 g/mol. Its IUPAC name is [4-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanylmethyl]phenyl]boronic acid.
| Compound Name | [4-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanylmethyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 63456783 |
| Molecular Formula | C11H14BN3O2S |
| Molecular Weight | 263.13 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | [4-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanylmethyl]phenyl]boronic acid |
| SMILES | Cc1nnc(SCc2ccc(B(O)O)cc2)n1C |
| InChI | InChI=1S/C11H14BN3O2S/c1-8-13-14-11(15(8)2)18-7-9-3-5-10(6-4-9)12(16)17/h3-6,16-17H,7H2,1-2H3 |
| InChIKey | VAFGIKNXIWWARE-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.13 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|