C10H11IN4S — CID 65479243
5-[(4-iodophenyl)methylsulfanyl]-4-methyl-1,2,4-triazol-3-amine (PubChem CID 65479243) has the molecular formula C10H11IN4S and a molecular weight of 346.20 g/mol. Its IUPAC name is 5-[(4-iodophenyl)methylsulfanyl]-4-methyl-1,2,4-triazol-3-amine.
| Compound Name | 5-[(4-iodophenyl)methylsulfanyl]-4-methyl-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 65479243 |
| Molecular Formula | C10H11IN4S |
| Molecular Weight | 346.20 g/mol |
| Exact Mass | 345.97 |
| IUPAC Name | 5-[(4-iodophenyl)methylsulfanyl]-4-methyl-1,2,4-triazol-3-amine |
| SMILES | Cn1c(N)nnc1SCc1ccc(I)cc1 |
| InChI | InChI=1S/C10H11IN4S/c1-15-9(12)13-14-10(15)16-6-7-2-4-8(11)5-3-7/h2-5H,6H2,1H3,(H2,12,13) |
| InChIKey | MDKOBPUUSINOQV-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.20 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|