C15H13BrCl3NO — CID 63456970
1-(4-bromophenyl)-1-(2,4,5-trichlorophenoxy)propan-2-amine (PubChem CID 63456970) has the molecular formula C15H13BrCl3NO and a molecular weight of 409.54 g/mol. Its IUPAC name is 1-(4-bromophenyl)-1-(2,4,5-trichlorophenoxy)propan-2-amine.
| Compound Name | 1-(4-bromophenyl)-1-(2,4,5-trichlorophenoxy)propan-2-amine |
|---|---|
| PubChem CID | 63456970 |
| Molecular Formula | C15H13BrCl3NO |
| Molecular Weight | 409.54 g/mol |
| Exact Mass | 406.92 |
| IUPAC Name | 1-(4-bromophenyl)-1-(2,4,5-trichlorophenoxy)propan-2-amine |
| SMILES | CC(N)C(Oc1cc(Cl)c(Cl)cc1Cl)c1ccc(Br)cc1 |
| InChI | InChI=1S/C15H13BrCl3NO/c1-8(20)15(9-2-4-10(16)5-3-9)21-14-7-12(18)11(17)6-13(14)19/h2-8,15H,20H2,1H3 |
| InChIKey | GPFIEUIBOVWDLP-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.54 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|