C17H22ClNOS — CID 63461400
2-(4-chloro-2-methyl-5-propan-2-ylphenoxy)-2-(5-methylthiophen-2-yl)ethanamine (PubChem CID 63461400) has the molecular formula C17H22ClNOS and a molecular weight of 323.89 g/mol. Its IUPAC name is 2-(4-chloro-2-methyl-5-propan-2-ylphenoxy)-2-(5-methylthiophen-2-yl)ethanamine.
| Compound Name | 2-(4-chloro-2-methyl-5-propan-2-ylphenoxy)-2-(5-methylthiophen-2-yl)ethanamine |
|---|---|
| PubChem CID | 63461400 |
| Molecular Formula | C17H22ClNOS |
| Molecular Weight | 323.89 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | 2-(4-chloro-2-methyl-5-propan-2-ylphenoxy)-2-(5-methylthiophen-2-yl)ethanamine |
| SMILES | Cc1ccc(C(CN)Oc2cc(C(C)C)c(Cl)cc2C)s1 |
| InChI | InChI=1S/C17H22ClNOS/c1-10(2)13-8-15(11(3)7-14(13)18)20-16(9-19)17-6-5-12(4)21-17/h5-8,10,16H,9,19H2,1-4H3 |
| InChIKey | LYORDFMIJFEZPO-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.89 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |