C14H15BrINOS — CID 63461575
1-(5-bromothiophen-2-yl)-1-(4-iodophenoxy)butan-2-amine (PubChem CID 63461575) has the molecular formula C14H15BrINOS and a molecular weight of 452.16 g/mol. Its IUPAC name is 1-(5-bromothiophen-2-yl)-1-(4-iodophenoxy)butan-2-amine.
| Compound Name | 1-(5-bromothiophen-2-yl)-1-(4-iodophenoxy)butan-2-amine |
|---|---|
| PubChem CID | 63461575 |
| Molecular Formula | C14H15BrINOS |
| Molecular Weight | 452.16 g/mol |
| Exact Mass | 450.91 |
| IUPAC Name | 1-(5-bromothiophen-2-yl)-1-(4-iodophenoxy)butan-2-amine |
| SMILES | CCC(N)C(Oc1ccc(I)cc1)c1ccc(Br)s1 |
| InChI | InChI=1S/C14H15BrINOS/c1-2-11(17)14(12-7-8-13(15)19-12)18-10-5-3-9(16)4-6-10/h3-8,11,14H,2,17H2,1H3 |
| InChIKey | HUEQUEHWDYAYRI-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.16 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|