C12H17BrF3NOS — CID 82788546
1-(5-bromothiophen-2-yl)-1-(4,4,4-trifluorobutoxy)butan-2-amine (PubChem CID 82788546) has the molecular formula C12H17BrF3NOS and a molecular weight of 360.24 g/mol. Its IUPAC name is 1-(5-bromothiophen-2-yl)-1-(4,4,4-trifluorobutoxy)butan-2-amine.
| Compound Name | 1-(5-bromothiophen-2-yl)-1-(4,4,4-trifluorobutoxy)butan-2-amine |
|---|---|
| PubChem CID | 82788546 |
| Molecular Formula | C12H17BrF3NOS |
| Molecular Weight | 360.24 g/mol |
| Exact Mass | 359.02 |
| IUPAC Name | 1-(5-bromothiophen-2-yl)-1-(4,4,4-trifluorobutoxy)butan-2-amine |
| SMILES | CCC(N)C(OCCCC(F)(F)F)c1ccc(Br)s1 |
| InChI | InChI=1S/C12H17BrF3NOS/c1-2-8(17)11(9-4-5-10(13)19-9)18-7-3-6-12(14,15)16/h4-5,8,11H,2-3,6-7,17H2,1H3 |
| InChIKey | PBMOTKSNNKGAHL-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.24 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|