C14H13BrN2O2 — CID 63462677
4-bromo-N-(3,5-dimethylphenyl)-2-nitroaniline (PubChem CID 63462677) has the molecular formula C14H13BrN2O2 and a molecular weight of 321.17 g/mol. Its IUPAC name is 4-bromo-N-(3,5-dimethylphenyl)-2-nitroaniline.
| Compound Name | 4-bromo-N-(3,5-dimethylphenyl)-2-nitroaniline |
|---|---|
| PubChem CID | 63462677 |
| Molecular Formula | C14H13BrN2O2 |
| Molecular Weight | 321.17 g/mol |
| Exact Mass | 320.02 |
| IUPAC Name | 4-bromo-N-(3,5-dimethylphenyl)-2-nitroaniline |
| SMILES | Cc1cc(C)cc(Nc2ccc(Br)cc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H13BrN2O2/c1-9-5-10(2)7-12(6-9)16-13-4-3-11(15)8-14(13)17(18)19/h3-8,16H,1-2H3 |
| InChIKey | NVGKXFSZPRQBAY-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.17 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|