C15H13N3O2 — CID 47115334
4-(3,5-dimethylanilino)-3-nitrobenzonitrile (PubChem CID 47115334) has the molecular formula C15H13N3O2 and a molecular weight of 267.29 g/mol. Its IUPAC name is 4-(3,5-dimethylanilino)-3-nitrobenzonitrile.
| Compound Name | 4-(3,5-dimethylanilino)-3-nitrobenzonitrile |
|---|---|
| PubChem CID | 47115334 |
| Molecular Formula | C15H13N3O2 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 4-(3,5-dimethylanilino)-3-nitrobenzonitrile |
| SMILES | Cc1cc(C)cc(Nc2ccc(C#N)cc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H13N3O2/c1-10-5-11(2)7-13(6-10)17-14-4-3-12(9-16)8-15(14)18(19)20/h3-8,17H,1-2H3 |
| InChIKey | LTMICNATIGGGAJ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 78.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|