C13H11BrClNO — CID 63462709
3-bromo-2-(4-chloro-3,5-dimethylphenoxy)pyridine (PubChem CID 63462709) has the molecular formula C13H11BrClNO and a molecular weight of 312.59 g/mol. Its IUPAC name is 3-bromo-2-(4-chloro-3,5-dimethylphenoxy)pyridine.
| Compound Name | 3-bromo-2-(4-chloro-3,5-dimethylphenoxy)pyridine |
|---|---|
| PubChem CID | 63462709 |
| Molecular Formula | C13H11BrClNO |
| Molecular Weight | 312.59 g/mol |
| Exact Mass | 310.97 |
| IUPAC Name | 3-bromo-2-(4-chloro-3,5-dimethylphenoxy)pyridine |
| SMILES | Cc1cc(Oc2ncccc2Br)cc(C)c1Cl |
| InChI | InChI=1S/C13H11BrClNO/c1-8-6-10(7-9(2)12(8)15)17-13-11(14)4-3-5-16-13/h3-7H,1-2H3 |
| InChIKey | JTLCKWOLJFHDBT-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.59 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |