C12H12ClN3O — CID 102987996
3-(4-chloro-3,5-dimethylphenoxy)pyrazin-2-amine (PubChem CID 102987996) has the molecular formula C12H12ClN3O and a molecular weight of 249.70 g/mol. Its IUPAC name is 3-(4-chloro-3,5-dimethylphenoxy)pyrazin-2-amine.
| Compound Name | 3-(4-chloro-3,5-dimethylphenoxy)pyrazin-2-amine |
|---|---|
| PubChem CID | 102987996 |
| Molecular Formula | C12H12ClN3O |
| Molecular Weight | 249.70 g/mol |
| Exact Mass | 249.07 |
| IUPAC Name | 3-(4-chloro-3,5-dimethylphenoxy)pyrazin-2-amine |
| SMILES | Cc1cc(Oc2nccnc2N)cc(C)c1Cl |
| InChI | InChI=1S/C12H12ClN3O/c1-7-5-9(6-8(2)10(7)13)17-12-11(14)15-3-4-16-12/h3-6H,1-2H3,(H2,14,15) |
| InChIKey | HBVZZIDEYUMSQO-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.70 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |