C16H18Br2N2 — CID 63464845
1-(2,4-dibromophenyl)-6,6-dimethyl-5,7-dihydro-4H-indol-4-amine (PubChem CID 63464845) has the molecular formula C16H18Br2N2 and a molecular weight of 398.14 g/mol. Its IUPAC name is 1-(2,4-dibromophenyl)-6,6-dimethyl-5,7-dihydro-4H-indol-4-amine.
| Compound Name | 1-(2,4-dibromophenyl)-6,6-dimethyl-5,7-dihydro-4H-indol-4-amine |
|---|---|
| PubChem CID | 63464845 |
| Molecular Formula | C16H18Br2N2 |
| Molecular Weight | 398.14 g/mol |
| Exact Mass | 395.98 |
| IUPAC Name | 1-(2,4-dibromophenyl)-6,6-dimethyl-5,7-dihydro-4H-indol-4-amine |
| SMILES | CC1(C)Cc2c(ccn2-c2ccc(Br)cc2Br)C(N)C1 |
| InChI | InChI=1S/C16H18Br2N2/c1-16(2)8-13(19)11-5-6-20(15(11)9-16)14-4-3-10(17)7-12(14)18/h3-7,13H,8-9,19H2,1-2H3 |
| InChIKey | CRSACVRGJIUNMK-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.14 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |