C16H21Cl2N3 — CID 63468374
3-butyl-5-(3,5-dichlorophenyl)-2-propan-2-ylimidazol-4-amine (PubChem CID 63468374) has the molecular formula C16H21Cl2N3 and a molecular weight of 326.27 g/mol. Its IUPAC name is 3-butyl-5-(3,5-dichlorophenyl)-2-propan-2-ylimidazol-4-amine.
| Compound Name | 3-butyl-5-(3,5-dichlorophenyl)-2-propan-2-ylimidazol-4-amine |
|---|---|
| PubChem CID | 63468374 |
| Molecular Formula | C16H21Cl2N3 |
| Molecular Weight | 326.27 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | 3-butyl-5-(3,5-dichlorophenyl)-2-propan-2-ylimidazol-4-amine |
| SMILES | CCCCn1c(C(C)C)nc(-c2cc(Cl)cc(Cl)c2)c1N |
| InChI | InChI=1S/C16H21Cl2N3/c1-4-5-6-21-15(19)14(20-16(21)10(2)3)11-7-12(17)9-13(18)8-11/h7-10H,4-6,19H2,1-3H3 |
| InChIKey | AKBVQFQSEAIFLL-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.27 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |