C17H24BrN3 — CID 66480273
5-(4-bromo-3-methylphenyl)-3-butyl-2-propan-2-ylimidazol-4-amine (PubChem CID 66480273) has the molecular formula C17H24BrN3 and a molecular weight of 350.30 g/mol. Its IUPAC name is 5-(4-bromo-3-methylphenyl)-3-butyl-2-propan-2-ylimidazol-4-amine.
| Compound Name | 5-(4-bromo-3-methylphenyl)-3-butyl-2-propan-2-ylimidazol-4-amine |
|---|---|
| PubChem CID | 66480273 |
| Molecular Formula | C17H24BrN3 |
| Molecular Weight | 350.30 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | 5-(4-bromo-3-methylphenyl)-3-butyl-2-propan-2-ylimidazol-4-amine |
| SMILES | CCCCn1c(C(C)C)nc(-c2ccc(Br)c(C)c2)c1N |
| InChI | InChI=1S/C17H24BrN3/c1-5-6-9-21-16(19)15(20-17(21)11(2)3)13-7-8-14(18)12(4)10-13/h7-8,10-11H,5-6,9,19H2,1-4H3 |
| InChIKey | AAGHYNZBYBIGSW-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.30 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |