C14H10BrF4N — CID 63477170
N-[1-(3-bromo-4-fluorophenyl)ethyl]-2,3,5-trifluoroaniline (PubChem CID 63477170) has the molecular formula C14H10BrF4N and a molecular weight of 348.14 g/mol. Its IUPAC name is N-[1-(3-bromo-4-fluorophenyl)ethyl]-2,3,5-trifluoroaniline.
| Compound Name | N-[1-(3-bromo-4-fluorophenyl)ethyl]-2,3,5-trifluoroaniline |
|---|---|
| PubChem CID | 63477170 |
| Molecular Formula | C14H10BrF4N |
| Molecular Weight | 348.14 g/mol |
| Exact Mass | 346.99 |
| IUPAC Name | N-[1-(3-bromo-4-fluorophenyl)ethyl]-2,3,5-trifluoroaniline |
| SMILES | CC(Nc1cc(F)cc(F)c1F)c1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C14H10BrF4N/c1-7(8-2-3-11(17)10(15)4-8)20-13-6-9(16)5-12(18)14(13)19/h2-7,20H,1H3 |
| InChIKey | FHFTZMNBZRTNJH-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.14 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|