C18H32N2S — CID 63484371
2-methyl-N-[[1-[[methyl(thiophen-2-ylmethyl)amino]methyl]cyclohexyl]methyl]propan-1-amine (PubChem CID 63484371) has the molecular formula C18H32N2S and a molecular weight of 308.53 g/mol. Its IUPAC name is 2-methyl-N-[[1-[[methyl(thiophen-2-ylmethyl)amino]methyl]cyclohexyl]methyl]propan-1-amine.
| Compound Name | 2-methyl-N-[[1-[[methyl(thiophen-2-ylmethyl)amino]methyl]cyclohexyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 63484371 |
| Molecular Formula | C18H32N2S |
| Molecular Weight | 308.53 g/mol |
| Exact Mass | 308.23 |
| IUPAC Name | 2-methyl-N-[[1-[[methyl(thiophen-2-ylmethyl)amino]methyl]cyclohexyl]methyl]propan-1-amine |
| SMILES | CC(C)CNCC1(CN(C)Cc2cccs2)CCCCC1 |
| InChI | InChI=1S/C18H32N2S/c1-16(2)12-19-14-18(9-5-4-6-10-18)15-20(3)13-17-8-7-11-21-17/h7-8,11,16,19H,4-6,9-10,12-15H2,1-3H3 |
| InChIKey | ODJBTKJJPOVCEE-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.53 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |