C23H40N2 — CID 113242307
N-[[1-[[benzyl(propan-2-yl)amino]methyl]cycloheptyl]methyl]-2-methylpropan-1-amine (PubChem CID 113242307) has the molecular formula C23H40N2 and a molecular weight of 344.59 g/mol. Its IUPAC name is N-[[1-[[benzyl(propan-2-yl)amino]methyl]cycloheptyl]methyl]-2-methylpropan-1-amine.
| Compound Name | N-[[1-[[benzyl(propan-2-yl)amino]methyl]cycloheptyl]methyl]-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 113242307 |
| Molecular Formula | C23H40N2 |
| Molecular Weight | 344.59 g/mol |
| Exact Mass | 344.32 |
| IUPAC Name | N-[[1-[[benzyl(propan-2-yl)amino]methyl]cycloheptyl]methyl]-2-methylpropan-1-amine |
| SMILES | CC(C)CNCC1(CN(Cc2ccccc2)C(C)C)CCCCCC1 |
| InChI | InChI=1S/C23H40N2/c1-20(2)16-24-18-23(14-10-5-6-11-15-23)19-25(21(3)4)17-22-12-8-7-9-13-22/h7-9,12-13,20-21,24H,5-6,10-11,14-19H2,1-4H3 |
| InChIKey | NFQGRGWZUFCXRU-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.59 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |