C17H22FN3 — CID 63485270
N-ethyl-2-(4-fluoro-3-methylphenyl)-6-methyl-5-propan-2-ylpyrimidin-4-amine (PubChem CID 63485270) has the molecular formula C17H22FN3 and a molecular weight of 287.38 g/mol. Its IUPAC name is N-ethyl-2-(4-fluoro-3-methylphenyl)-6-methyl-5-propan-2-ylpyrimidin-4-amine.
| Compound Name | N-ethyl-2-(4-fluoro-3-methylphenyl)-6-methyl-5-propan-2-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 63485270 |
| Molecular Formula | C17H22FN3 |
| Molecular Weight | 287.38 g/mol |
| Exact Mass | 287.18 |
| IUPAC Name | N-ethyl-2-(4-fluoro-3-methylphenyl)-6-methyl-5-propan-2-ylpyrimidin-4-amine |
| SMILES | CCNc1nc(-c2ccc(F)c(C)c2)nc(C)c1C(C)C |
| InChI | InChI=1S/C17H22FN3/c1-6-19-17-15(10(2)3)12(5)20-16(21-17)13-7-8-14(18)11(4)9-13/h7-10H,6H2,1-5H3,(H,19,20,21) |
| InChIKey | PYJRWERXIKBQON-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.38 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |