C15H14BrN3S — CID 63486940
2-[(4-bromophenyl)methyl]-N-ethylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 63486940) has the molecular formula C15H14BrN3S and a molecular weight of 348.27 g/mol. Its IUPAC name is 2-[(4-bromophenyl)methyl]-N-ethylthieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-[(4-bromophenyl)methyl]-N-ethylthieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 63486940 |
| Molecular Formula | C15H14BrN3S |
| Molecular Weight | 348.27 g/mol |
| Exact Mass | 347.01 |
| IUPAC Name | 2-[(4-bromophenyl)methyl]-N-ethylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | CCNc1nc(Cc2ccc(Br)cc2)nc2sccc12 |
| InChI | InChI=1S/C15H14BrN3S/c1-2-17-14-12-7-8-20-15(12)19-13(18-14)9-10-3-5-11(16)6-4-10/h3-8H,2,9H2,1H3,(H,17,18,19) |
| InChIKey | CAVDDCFGUSLGPX-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.27 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |