C14H12Cl2INO — CID 63489373
1-(2,5-dichlorophenyl)-2-(3-iodoanilino)ethanol (PubChem CID 63489373) has the molecular formula C14H12Cl2INO and a molecular weight of 408.07 g/mol. Its IUPAC name is 1-(2,5-dichlorophenyl)-2-(3-iodoanilino)ethanol.
| Compound Name | 1-(2,5-dichlorophenyl)-2-(3-iodoanilino)ethanol |
|---|---|
| PubChem CID | 63489373 |
| Molecular Formula | C14H12Cl2INO |
| Molecular Weight | 408.07 g/mol |
| Exact Mass | 406.93 |
| IUPAC Name | 1-(2,5-dichlorophenyl)-2-(3-iodoanilino)ethanol |
| SMILES | OC(CNc1cccc(I)c1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C14H12Cl2INO/c15-9-4-5-13(16)12(6-9)14(19)8-18-11-3-1-2-10(17)7-11/h1-7,14,18-19H,8H2 |
| InChIKey | NBSOAYWUBBHWEJ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.07 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|