C17H17Cl2NO — CID 60896402
1-(2,5-dichlorophenyl)-2-(2,3-dihydro-1H-inden-5-ylamino)ethanol (PubChem CID 60896402) has the molecular formula C17H17Cl2NO and a molecular weight of 322.24 g/mol. Its IUPAC name is 1-(2,5-dichlorophenyl)-2-(2,3-dihydro-1H-inden-5-ylamino)ethanol.
| Compound Name | 1-(2,5-dichlorophenyl)-2-(2,3-dihydro-1H-inden-5-ylamino)ethanol |
|---|---|
| PubChem CID | 60896402 |
| Molecular Formula | C17H17Cl2NO |
| Molecular Weight | 322.24 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | 1-(2,5-dichlorophenyl)-2-(2,3-dihydro-1H-inden-5-ylamino)ethanol |
| SMILES | OC(CNc1ccc2c(c1)CCC2)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C17H17Cl2NO/c18-13-5-7-16(19)15(9-13)17(21)10-20-14-6-4-11-2-1-3-12(11)8-14/h4-9,17,20-21H,1-3,10H2 |
| InChIKey | HTCDURCZZURCNK-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.24 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |