C27H21NO5 — CID 634902
dimethyl 6-oxo-1,4,5-triphenylpyridine-2,3-dicarboxylate (PubChem CID 634902) has the molecular formula C27H21NO5 and a molecular weight of 439.47 g/mol. Its IUPAC name is dimethyl 6-oxo-1,4,5-triphenylpyridine-2,3-dicarboxylate.
| Compound Name | dimethyl 6-oxo-1,4,5-triphenylpyridine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 634902 |
| Molecular Formula | C27H21NO5 |
| Molecular Weight | 439.47 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | dimethyl 6-oxo-1,4,5-triphenylpyridine-2,3-dicarboxylate |
| SMILES | COC(=O)c1c(-c2ccccc2)c(-c2ccccc2)c(=O)n(-c2ccccc2)c1C(=O)OC |
| InChI | InChI=1S/C27H21NO5/c1-32-26(30)23-21(18-12-6-3-7-13-18)22(19-14-8-4-9-15-19)25(29)28(24(23)27(31)33-2)20-16-10-5-11-17-20/h3-17H,1-2H3 |
| InChIKey | KKSVXHQHYXEXFQ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 74.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.47 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |