C18H40N2 — CID 63493237
N-butan-2-yl-N-butyl-2-methyl-N',2-dipropylpropane-1,3-diamine (PubChem CID 63493237) has the molecular formula C18H40N2 and a molecular weight of 284.53 g/mol. Its IUPAC name is N-butan-2-yl-N-butyl-2-methyl-N',2-dipropylpropane-1,3-diamine.
| Compound Name | N-butan-2-yl-N-butyl-2-methyl-N',2-dipropylpropane-1,3-diamine |
|---|---|
| PubChem CID | 63493237 |
| Molecular Formula | C18H40N2 |
| Molecular Weight | 284.53 g/mol |
| Exact Mass | 284.32 |
| IUPAC Name | N-butan-2-yl-N-butyl-2-methyl-N',2-dipropylpropane-1,3-diamine |
| SMILES | CCCCN(CC(C)(CCC)CNCCC)C(C)CC |
| InChI | InChI=1S/C18H40N2/c1-7-11-14-20(17(5)10-4)16-18(6,12-8-2)15-19-13-9-3/h17,19H,7-16H2,1-6H3 |
| InChIKey | ZKPTZZLIIQHYFA-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.53 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|