C17H38N2 — CID 63494582
N-(3,3-dimethylbutan-2-yl)-N,2-dimethyl-N',2-dipropylpropane-1,3-diamine (PubChem CID 63494582) has the molecular formula C17H38N2 and a molecular weight of 270.50 g/mol. Its IUPAC name is N-(3,3-dimethylbutan-2-yl)-N,2-dimethyl-N',2-dipropylpropane-1,3-diamine.
| Compound Name | N-(3,3-dimethylbutan-2-yl)-N,2-dimethyl-N',2-dipropylpropane-1,3-diamine |
|---|---|
| PubChem CID | 63494582 |
| Molecular Formula | C17H38N2 |
| Molecular Weight | 270.50 g/mol |
| Exact Mass | 270.30 |
| IUPAC Name | N-(3,3-dimethylbutan-2-yl)-N,2-dimethyl-N',2-dipropylpropane-1,3-diamine |
| SMILES | CCCNCC(C)(CCC)CN(C)C(C)C(C)(C)C |
| InChI | InChI=1S/C17H38N2/c1-9-11-17(7,13-18-12-10-2)14-19(8)15(3)16(4,5)6/h15,18H,9-14H2,1-8H3 |
| InChIKey | MFOBOKTTYCPEBU-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.50 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|