About N-[[4-[(3,5-dichlorophenoxy)methyl]-5-methylfuran-2-yl]methyl]propan-2-amine
N-[[4-[(3,5-dichlorophenoxy)methyl]-5-methylfuran-2-yl]methyl]propan-2-amine (PubChem CID 63496300) has the molecular formula C16H19Cl2NO2
and a molecular weight of 328.24 g/mol. Its IUPAC name is N-[[4-[(3,5-dichlorophenoxy)methyl]-5-methylfuran-2-yl]methyl]propan-2-amine.
Molecular Properties
| Compound Name | N-[[4-[(3,5-dichlorophenoxy)methyl]-5-methylfuran-2-yl]methyl]propan-2-amine |
| PubChem CID | 63496300 |
| Molecular Formula | C16H19Cl2NO2 |
| Molecular Weight | 328.24 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | N-[[4-[(3,5-dichlorophenoxy)methyl]-5-methylfuran-2-yl]methyl]propan-2-amine |
| SMILES | Cc1oc(CNC(C)C)cc1COc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C16H19Cl2NO2/c1-10(2)19-8-16-4-12(11(3)21-16)9-20-15-6-13(17)5-14(18)7-15/h4-7,10,19H,8-9H2,1-3H3 |
| InChIKey | KDUCKUOZECQXPU-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.24 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[[4-[(3,5-dichlorophenoxy)methyl]-5-methylfuran-2-yl]methyl]propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[4-[(3,5-dichlorophenoxy)methyl]-5-methylfuran-2-yl]methyl]propan-2-amine?
The IUPAC name of N-[[4-[(3,5-dichlorophenoxy)methyl]-5-methylfuran-2-yl]methyl]propan-2-amine (CID 63496300) is N-[[4-[(3,5-dichlorophenoxy)methyl]-5-methylfuran-2-yl]methyl]propan-2-amine.
What is the SMILES notation for N-[[4-[(3,5-dichlorophenoxy)methyl]-5-methylfuran-2-yl]methyl]propan-2-amine?
The canonical SMILES for N-[[4-[(3,5-dichlorophenoxy)methyl]-5-methylfuran-2-yl]methyl]propan-2-amine is Cc1oc(CNC(C)C)cc1COc1cc(Cl)cc(Cl)c1.
What is the InChIKey of N-[[4-[(3,5-dichlorophenoxy)methyl]-5-methylfuran-2-yl]methyl]propan-2-amine?
The InChIKey is KDUCKUOZECQXPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19Cl2NO2/c1-10(2)19-8-16-4-12(11(3)21-16)9-20-15-6-13(17)5-14(18)7-15/h4-7,10,19H,8-9H2,1-3H3.
What are the key properties of N-[[4-[(3,5-dichlorophenoxy)methyl]-5-methylfuran-2-yl]methyl]propan-2-amine?
N-[[4-[(3,5-dichlorophenoxy)methyl]-5-methylfuran-2-yl]methyl]propan-2-amine has a molecular weight of 328.24 g/mol, XLogP of 4.97, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[4-[(3,5-dichlorophenoxy)methyl]-5-methylfuran-2-yl]methyl]propan-2-amine is sourced from PubChem (CID 63496300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).