C16H19BrClNO2 — CID 63497884
N-[[5-[(2-bromo-4-chlorophenoxy)methyl]-3-methylfuran-2-yl]methyl]propan-2-amine (PubChem CID 63497884) has the molecular formula C16H19BrClNO2 and a molecular weight of 372.69 g/mol. Its IUPAC name is N-[[5-[(2-bromo-4-chlorophenoxy)methyl]-3-methylfuran-2-yl]methyl]propan-2-amine.
| Compound Name | N-[[5-[(2-bromo-4-chlorophenoxy)methyl]-3-methylfuran-2-yl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 63497884 |
| Molecular Formula | C16H19BrClNO2 |
| Molecular Weight | 372.69 g/mol |
| Exact Mass | 371.03 |
| IUPAC Name | N-[[5-[(2-bromo-4-chlorophenoxy)methyl]-3-methylfuran-2-yl]methyl]propan-2-amine |
| SMILES | Cc1cc(COc2ccc(Cl)cc2Br)oc1CNC(C)C |
| InChI | InChI=1S/C16H19BrClNO2/c1-10(2)19-8-16-11(3)6-13(21-16)9-20-15-5-4-12(18)7-14(15)17/h4-7,10,19H,8-9H2,1-3H3 |
| InChIKey | RXOJBZASHZHHBK-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.69 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |